C21H26F3N3O7S — CID 134567656
[5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1-phenylpyrazol-3-yl] trifluoromethanesulfonate (PubChem CID 134567656) has the molecular formula C21H26F3N3O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is [5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1-phenylpyrazol-3-yl] trifluoromethanesulfonate.
| Compound Name | [5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1-phenylpyrazol-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134567656 |
| Molecular Formula | C21H26F3N3O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1-phenylpyrazol-3-yl] trifluoromethanesulfonate |
| SMILES | Cc1c(OS(=O)(=O)C(F)(F)F)nn(-c2ccccc2)c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26F3N3O7S/c1-13-15(34-35(30,31)21(22,23)24)25-27(14-11-9-8-10-12-14)16(13)26(17(28)32-19(2,3)4)18(29)33-20(5,6)7/h8-12H,1-7H3 |
| InChIKey | WRKPVTKURALBJJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 117.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|