C24H26N4O3 — CID 139822596
tert-butyl N-benzyl-N-[4-cyano-3-(2-hydroxyethyl)-1-phenylpyrazol-5-yl]carbamate (PubChem CID 139822596) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[4-cyano-3-(2-hydroxyethyl)-1-phenylpyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[4-cyano-3-(2-hydroxyethyl)-1-phenylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 139822596 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl N-benzyl-N-[4-cyano-3-(2-hydroxyethyl)-1-phenylpyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)c1c(C#N)c(CCO)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H26N4O3/c1-24(2,3)31-23(30)27(17-18-10-6-4-7-11-18)22-20(16-25)21(14-15-29)26-28(22)19-12-8-5-9-13-19/h4-13,29H,14-15,17H2,1-3H3 |
| InChIKey | XKRFVBOALRLZDC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |