About 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine
2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine (PubChem CID 134572260) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine.
Analyze 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine?
The IUPAC name of 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine (CID 134572260) is 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine.
What is the SMILES notation for 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine?
The canonical SMILES for 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine is C=C(CN)N(C)CCC(C)C.
What is the InChIKey of 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine?
The InChIKey is UMZGYGJVUCTVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-8(2)5-6-11(4)9(3)7-10/h8H,3,5-7,10H2,1-2,4H3.
What are the key properties of 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine?
2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-2-N-(3-methylbutyl)prop-2-ene-1,2-diamine is sourced from PubChem (CID 134572260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).