C18H16Cl3N3OS — CID 1345726
N-[(1R)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]acetamide (PubChem CID 1345726) has the molecular formula C18H16Cl3N3OS and a molecular weight of 428.77 g/mol. Its IUPAC name is N-[(1R)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]acetamide.
| Compound Name | N-[(1R)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]acetamide |
|---|---|
| PubChem CID | 1345726 |
| Molecular Formula | C18H16Cl3N3OS |
| Molecular Weight | 428.77 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | N-[(1R)-1-(2-benzylsulfanylbenzimidazol-1-yl)-2,2,2-trichloroethyl]acetamide |
| SMILES | CC(=O)N[C@H](n1c(SCc2ccccc2)nc2ccccc21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H16Cl3N3OS/c1-12(25)22-16(18(19,20)21)24-15-10-6-5-9-14(15)23-17(24)26-11-13-7-3-2-4-8-13/h2-10,16H,11H2,1H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | VLYBLDBTQGGTFN-MRXNPFEDSA-N |
| XLogP | 5.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|