C18H14Cl4N4O2S — CID 7147360
N-(4-chlorophenyl)-2-[1-[(1S)-2,2,2-trichloro-1-formamidoethyl]benzimidazol-2-yl]sulfanylacetamide (PubChem CID 7147360) has the molecular formula C18H14Cl4N4O2S and a molecular weight of 492.22 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-[(1S)-2,2,2-trichloro-1-formamidoethyl]benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-[(1S)-2,2,2-trichloro-1-formamidoethyl]benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7147360 |
| Molecular Formula | C18H14Cl4N4O2S |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-[(1S)-2,2,2-trichloro-1-formamidoethyl]benzimidazol-2-yl]sulfanylacetamide |
| SMILES | O=CN[C@@H](n1c(SCC(=O)Nc2ccc(Cl)cc2)nc2ccccc21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H14Cl4N4O2S/c19-11-5-7-12(8-6-11)24-15(28)9-29-17-25-13-3-1-2-4-14(13)26(17)16(23-10-27)18(20,21)22/h1-8,10,16H,9H2,(H,23,27)(H,24,28)/t16-/m0/s1 |
| InChIKey | YWOZPQXUGGOFAL-INIZCTEOSA-N |
| XLogP | 5.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|