C12H15Br2NO — CID 134575639
2,3-dibromo-3-(4-prop-2-enoxyphenyl)propan-1-amine (PubChem CID 134575639) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 2,3-dibromo-3-(4-prop-2-enoxyphenyl)propan-1-amine.
| Compound Name | 2,3-dibromo-3-(4-prop-2-enoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 134575639 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2,3-dibromo-3-(4-prop-2-enoxyphenyl)propan-1-amine |
| SMILES | C=CCOc1ccc(C(Br)C(Br)CN)cc1 |
| InChI | InChI=1S/C12H15Br2NO/c1-2-7-16-10-5-3-9(4-6-10)12(14)11(13)8-15/h2-6,11-12H,1,7-8,15H2 |
| InChIKey | YZNHUBNULREQOI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|