C24H23N3O4S2 — CID 134578623
(3S,7R)-2-(1,3-benzodioxol-5-yl)-7-benzyl-3,8-dimethyl-9,11-dioxo-5,6-dithia-1,8-diazabicyclo[5.3.1]undecane-3-carbonitrile (PubChem CID 134578623) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (3S,7R)-2-(1,3-benzodioxol-5-yl)-7-benzyl-3,8-dimethyl-9,11-dioxo-5,6-dithia-1,8-diazabicyclo[5.3.1]undecane-3-carbonitrile.
| Compound Name | (3S,7R)-2-(1,3-benzodioxol-5-yl)-7-benzyl-3,8-dimethyl-9,11-dioxo-5,6-dithia-1,8-diazabicyclo[5.3.1]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 134578623 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (3S,7R)-2-(1,3-benzodioxol-5-yl)-7-benzyl-3,8-dimethyl-9,11-dioxo-5,6-dithia-1,8-diazabicyclo[5.3.1]undecane-3-carbonitrile |
| SMILES | CN1C(=O)CN2C(=O)[C@@]1(Cc1ccccc1)SSC[C@](C)(C#N)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N3O4S2/c1-23(13-25)14-32-33-24(11-16-6-4-3-5-7-16)22(29)27(12-20(28)26(24)2)21(23)17-8-9-18-19(10-17)31-15-30-18/h3-10,21H,11-12,14-15H2,1-2H3/t21?,23-,24+/m0/s1 |
| InChIKey | SQOZDWJMOCQLEM-RPFBHVFUSA-N |
| XLogP | 3.62 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|