C15H23N5O2S — CID 13457967
1-(2-hydrazinylpyrimidin-4-yl)oxy-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol (PubChem CID 13457967) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-(2-hydrazinylpyrimidin-4-yl)oxy-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol.
| Compound Name | 1-(2-hydrazinylpyrimidin-4-yl)oxy-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 13457967 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(2-hydrazinylpyrimidin-4-yl)oxy-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol |
| SMILES | CC(C)(Cc1cccs1)NCC(O)COc1ccnc(NN)n1 |
| InChI | InChI=1S/C15H23N5O2S/c1-15(2,8-12-4-3-7-23-12)18-9-11(21)10-22-13-5-6-17-14(19-13)20-16/h3-7,11,18,21H,8-10,16H2,1-2H3,(H,17,19,20) |
| InChIKey | BOVQJNZXONGEPA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|