C18H25NO2S — CID 13096685
1-(2-methylphenoxy)-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol (PubChem CID 13096685) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-(2-methylphenoxy)-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol.
| Compound Name | 1-(2-methylphenoxy)-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 13096685 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-(2-methylphenoxy)-3-[(2-methyl-1-thiophen-2-ylpropan-2-yl)amino]propan-2-ol |
| SMILES | Cc1ccccc1OCC(O)CNC(C)(C)Cc1cccs1 |
| InChI | InChI=1S/C18H25NO2S/c1-14-7-4-5-9-17(14)21-13-15(20)12-19-18(2,3)11-16-8-6-10-22-16/h4-10,15,19-20H,11-13H2,1-3H3 |
| InChIKey | GVFALUKIIWFLCF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |