C13H17NO — CID 134580493
(3S)-2,3-dimethyl-3-pyridin-2-ylcyclohexen-1-ol (PubChem CID 134580493) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (3S)-2,3-dimethyl-3-pyridin-2-ylcyclohexen-1-ol.
| Compound Name | (3S)-2,3-dimethyl-3-pyridin-2-ylcyclohexen-1-ol |
|---|---|
| PubChem CID | 134580493 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3S)-2,3-dimethyl-3-pyridin-2-ylcyclohexen-1-ol |
| SMILES | CC1=C(O)CCC[C@]1(C)c1ccccn1 |
| InChI | InChI=1S/C13H17NO/c1-10-11(15)6-5-8-13(10,2)12-7-3-4-9-14-12/h3-4,7,9,15H,5-6,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | BDLPGXAXRBVLHB-ZDUSSCGKSA-N |
| XLogP | 3.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |