C16H30O10 — CID 134581573
(1R,2S,3S,4R,5R)-5-[2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]cyclohexane-1,2,3,4-tetrol (PubChem CID 134581573) has the molecular formula C16H30O10 and a molecular weight of 382.41 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-5-[2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4R,5R)-5-[2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 134581573 |
| Molecular Formula | C16H30O10 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (1R,2S,3S,4R,5R)-5-[2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]cyclohexane-1,2,3,4-tetrol |
| SMILES | CC(C)(CC1C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30O10/c1-16(2,4-6-3-7(18)10(20)12(22)9(6)19)26-15-14(24)13(23)11(21)8(5-17)25-15/h6-15,17-24H,3-5H2,1-2H3/t6?,7-,8-,9-,10+,11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | OMTHRXJFRURNQE-RJJCZGEASA-N |
| XLogP | -3.56 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |