C36H67N7O — CID 134582989
2-[4-[5-[(2R,5S)-4-(4-tert-butylpiperazin-1-yl)-2,5-dimethylpiperidin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazin-1-yl]-4-(2,2-dimethylpropoxy)pyrimidine (PubChem CID 134582989) has the molecular formula C36H67N7O and a molecular weight of 613.98 g/mol. Its IUPAC name is 2-[4-[5-[(2R,5S)-4-(4-tert-butylpiperazin-1-yl)-2,5-dimethylpiperidin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazin-1-yl]-4-(2,2-dimethylpropoxy)pyrimidine.
| Compound Name | 2-[4-[5-[(2R,5S)-4-(4-tert-butylpiperazin-1-yl)-2,5-dimethylpiperidin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazin-1-yl]-4-(2,2-dimethylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 134582989 |
| Molecular Formula | C36H67N7O |
| Molecular Weight | 613.98 g/mol |
| Exact Mass | 613.54 |
| IUPAC Name | 2-[4-[5-[(2R,5S)-4-(4-tert-butylpiperazin-1-yl)-2,5-dimethylpiperidin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazin-1-yl]-4-(2,2-dimethylpropoxy)pyrimidine |
| SMILES | C[C@@H]1CC(N2CCN(C(C)(C)C)CC2)[C@@H](C)CN1CC(C)(C)CC(C)(C)N1CCN(c2nccc(OCC(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C36H67N7O/c1-28-24-41(29(2)23-30(28)39-15-19-42(20-16-39)34(6,7)8)26-35(9,10)25-36(11,12)43-21-17-40(18-22-43)32-37-14-13-31(38-32)44-27-33(3,4)5/h13-14,28-30H,15-27H2,1-12H3/t28-,29+,30?/m0/s1 |
| InChIKey | HXOHAOIOSSJATH-UOCPRXARSA-N |
| XLogP | 5.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.98 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |