C22H21ClF2N4O2S — CID 134585336
4-[[2-(azetidin-1-ylmethyl)phenyl]methylamino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 134585336) has the molecular formula C22H21ClF2N4O2S and a molecular weight of 478.95 g/mol. Its IUPAC name is 4-[[2-(azetidin-1-ylmethyl)phenyl]methylamino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[[2-(azetidin-1-ylmethyl)phenyl]methylamino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134585336 |
| Molecular Formula | C22H21ClF2N4O2S |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-[[2-(azetidin-1-ylmethyl)phenyl]methylamino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1cc(Cl)c(NCc2ccccc2CN2CCC2)cc1F |
| InChI | InChI=1S/C22H21ClF2N4O2S/c23-17-11-20(32(30,31)28-22-8-3-7-21(25)27-22)18(24)12-19(17)26-13-15-5-1-2-6-16(15)14-29-9-4-10-29/h1-3,5-8,11-12,26H,4,9-10,13-14H2,(H,27,28) |
| InChIKey | HTAYXPPAYZCKKD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|