C14H23NaO7S — CID 134586980
sodium 4-(1,2-diethylcyclohexyl)oxy-4-oxo-3-sulfobutanoate (PubChem CID 134586980) has the molecular formula C14H23NaO7S and a molecular weight of 358.39 g/mol. Its IUPAC name is sodium 4-(1,2-diethylcyclohexyl)oxy-4-oxo-3-sulfobutanoate.
| Compound Name | sodium 4-(1,2-diethylcyclohexyl)oxy-4-oxo-3-sulfobutanoate |
|---|---|
| PubChem CID | 134586980 |
| Molecular Formula | C14H23NaO7S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | sodium 4-(1,2-diethylcyclohexyl)oxy-4-oxo-3-sulfobutanoate |
| SMILES | CCC1CCCCC1(CC)OC(=O)C(CC(=O)[O-])S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C14H24O7S.Na/c1-3-10-7-5-6-8-14(10,4-2)21-13(17)11(9-12(15)16)22(18,19)20;/h10-11H,3-9H2,1-2H3,(H,15,16)(H,18,19,20);/q;+1/p-1 |
| InChIKey | SDPDLFKDBMRDSU-UHFFFAOYSA-M |
| XLogP | -2.32 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|