C15H15ClFN3O — CID 134589812
3-[2-(3-chloro-2,2-dimethylpropanoyl)-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile (PubChem CID 134589812) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 3-[2-(3-chloro-2,2-dimethylpropanoyl)-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[2-(3-chloro-2,2-dimethylpropanoyl)-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 134589812 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[2-(3-chloro-2,2-dimethylpropanoyl)-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile |
| SMILES | CC(C)(CCl)C(=O)N1N=CCC1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C15H15ClFN3O/c1-15(2,9-16)14(21)20-13(3-4-19-20)11-5-10(8-18)6-12(17)7-11/h4-7,13H,3,9H2,1-2H3 |
| InChIKey | YOBFTXNERJPMQB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|