C16H15ClF3N3O — CID 153437092
2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylbutan-1-one (PubChem CID 153437092) has the molecular formula C16H15ClF3N3O and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylbutan-1-one.
| Compound Name | 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 153437092 |
| Molecular Formula | C16H15ClF3N3O |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylbutan-1-one |
| SMILES | [C-]#[N+]c1cc(F)cc(C2CC=NN2C(=O)C(C)(CCl)C(C)(F)F)c1 |
| InChI | InChI=1S/C16H15ClF3N3O/c1-15(9-17,16(2,19)20)14(24)23-13(4-5-22-23)10-6-11(18)8-12(7-10)21-3/h5-8,13H,4,9H2,1-2H3 |
| InChIKey | PBLUYSJTVHVAQJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|