C15H13ClF3N3O — CID 153437089
2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylpropan-1-one (PubChem CID 153437089) has the molecular formula C15H13ClF3N3O and a molecular weight of 343.74 g/mol. Its IUPAC name is 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylpropan-1-one.
| Compound Name | 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 153437089 |
| Molecular Formula | C15H13ClF3N3O |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(chloromethyl)-3,3-difluoro-1-[3-(3-fluoro-5-isocyanophenyl)-3,4-dihydropyrazol-2-yl]-2-methylpropan-1-one |
| SMILES | [C-]#[N+]c1cc(F)cc(C2CC=NN2C(=O)C(C)(CCl)C(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3N3O/c1-15(8-16,13(18)19)14(23)22-12(3-4-21-22)9-5-10(17)7-11(6-9)20-2/h4-7,12-13H,3,8H2,1H3 |
| InChIKey | MMEYNHCQAHGHBE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|