C15H15BrClF2N3O — CID 134600417
1-[3-(5-bromo-3-pyridinyl)-3,4-dihydropyrazol-2-yl]-2-(chloromethyl)-2-(difluoromethyl)pent-4-en-1-one (PubChem CID 134600417) has the molecular formula C15H15BrClF2N3O and a molecular weight of 406.66 g/mol. Its IUPAC name is 1-[3-(5-bromo-3-pyridinyl)-3,4-dihydropyrazol-2-yl]-2-(chloromethyl)-2-(difluoromethyl)pent-4-en-1-one.
| Compound Name | 1-[3-(5-bromo-3-pyridinyl)-3,4-dihydropyrazol-2-yl]-2-(chloromethyl)-2-(difluoromethyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 134600417 |
| Molecular Formula | C15H15BrClF2N3O |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 1-[3-(5-bromo-3-pyridinyl)-3,4-dihydropyrazol-2-yl]-2-(chloromethyl)-2-(difluoromethyl)pent-4-en-1-one |
| SMILES | C=CCC(CCl)(C(=O)N1N=CCC1c1cncc(Br)c1)C(F)F |
| InChI | InChI=1S/C15H15BrClF2N3O/c1-2-4-15(9-17,13(18)19)14(23)22-12(3-5-21-22)10-6-11(16)8-20-7-10/h2,5-8,12-13H,1,3-4,9H2 |
| InChIKey | PWHBBKHHXNPTOL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|