C16H17ClFN3O — CID 134600415
3-[2-[2-(chloromethyl)-2-methylbutanoyl]-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile (PubChem CID 134600415) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 3-[2-[2-(chloromethyl)-2-methylbutanoyl]-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[2-[2-(chloromethyl)-2-methylbutanoyl]-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 134600415 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-[2-[2-(chloromethyl)-2-methylbutanoyl]-3,4-dihydropyrazol-3-yl]-5-fluorobenzonitrile |
| SMILES | CCC(C)(CCl)C(=O)N1N=CCC1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C16H17ClFN3O/c1-3-16(2,10-17)15(22)21-14(4-5-20-21)12-6-11(9-19)7-13(18)8-12/h5-8,14H,3-4,10H2,1-2H3 |
| InChIKey | VMVZUPXIVSZNAG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|