C10H8N6O14 — CID 134590713
[3-[4,5-bis(nitrooxymethyl)-1,2-oxazol-3-yl]-4-(nitrooxymethyl)-1,2-oxazol-5-yl]methyl nitrate (PubChem CID 134590713) has the molecular formula C10H8N6O14 and a molecular weight of 436.20 g/mol. Its IUPAC name is [3-[4,5-bis(nitrooxymethyl)-1,2-oxazol-3-yl]-4-(nitrooxymethyl)-1,2-oxazol-5-yl]methyl nitrate.
| Compound Name | [3-[4,5-bis(nitrooxymethyl)-1,2-oxazol-3-yl]-4-(nitrooxymethyl)-1,2-oxazol-5-yl]methyl nitrate |
|---|---|
| PubChem CID | 134590713 |
| Molecular Formula | C10H8N6O14 |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | [3-[4,5-bis(nitrooxymethyl)-1,2-oxazol-3-yl]-4-(nitrooxymethyl)-1,2-oxazol-5-yl]methyl nitrate |
| SMILES | O=[N+]([O-])OCc1onc(-c2noc(CO[N+](=O)[O-])c2CO[N+](=O)[O-])c1CO[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N6O14/c17-13(18)25-1-5-7(3-27-15(21)22)29-11-9(5)10-6(2-26-14(19)20)8(30-12-10)4-28-16(23)24/h1-4H2 |
| InChIKey | APDWSHMSJMDRAL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 261.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|