C8H8N12O12 — CID 177464015
[4-[(E)-[3,5-bis(nitrooxymethyl)-1,2,4-triazol-4-yl]diazenyl]-5-(nitrooxymethyl)-1,2,4-triazol-3-yl]methyl nitrate (PubChem CID 177464015) has the molecular formula C8H8N12O12 and a molecular weight of 464.22 g/mol. Its IUPAC name is [4-[(E)-[3,5-bis(nitrooxymethyl)-1,2,4-triazol-4-yl]diazenyl]-5-(nitrooxymethyl)-1,2,4-triazol-3-yl]methyl nitrate.
| Compound Name | [4-[(E)-[3,5-bis(nitrooxymethyl)-1,2,4-triazol-4-yl]diazenyl]-5-(nitrooxymethyl)-1,2,4-triazol-3-yl]methyl nitrate |
|---|---|
| PubChem CID | 177464015 |
| Molecular Formula | C8H8N12O12 |
| Molecular Weight | 464.22 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [4-[(E)-[3,5-bis(nitrooxymethyl)-1,2,4-triazol-4-yl]diazenyl]-5-(nitrooxymethyl)-1,2,4-triazol-3-yl]methyl nitrate |
| SMILES | O=[N+]([O-])OCc1nnc(CO[N+](=O)[O-])n1/N=N/n1c(CO[N+](=O)[O-])nnc1CO[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N12O12/c21-17(22)29-1-5-9-10-6(2-30-18(23)24)15(5)13-14-16-7(3-31-19(25)26)11-12-8(16)4-32-20(27)28/h1-4H2/b14-13+ |
| InChIKey | ASIZQOQARZGCFG-BUHFOSPRSA-N |
| XLogP | -1.62 |
| TPSA | 295.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|