C21H22N4OS — CID 134591203
[4-[3-[4-(6-methyl-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-3-methylsulfanylbut-1-en-2-yl]cyanamide (PubChem CID 134591203) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is [4-[3-[4-(6-methyl-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-3-methylsulfanylbut-1-en-2-yl]cyanamide.
| Compound Name | [4-[3-[4-(6-methyl-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-3-methylsulfanylbut-1-en-2-yl]cyanamide |
|---|---|
| PubChem CID | 134591203 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-[3-[4-(6-methyl-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-3-methylsulfanylbut-1-en-2-yl]cyanamide |
| SMILES | C=C(NC#N)C(CC1CC(c2ccc(-c3ccc(C)nc3)cc2)=NO1)SC |
| InChI | InChI=1S/C21H22N4OS/c1-14-4-5-18(12-23-14)16-6-8-17(9-7-16)20-10-19(26-25-20)11-21(27-3)15(2)24-13-22/h4-9,12,19,21,24H,2,10-11H2,1,3H3 |
| InChIKey | PLDZKNQYJFEQDW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|