C29H30ClFN4O4 — CID 134593957
5-[(1R)-1-(3-chloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]-1-(oxan-2-yl)indazole (PubChem CID 134593957) has the molecular formula C29H30ClFN4O4 and a molecular weight of 553.03 g/mol. Its IUPAC name is 5-[(1R)-1-(3-chloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(1R)-1-(3-chloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 134593957 |
| Molecular Formula | C29H30ClFN4O4 |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 5-[(1R)-1-(3-chloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]-1-(oxan-2-yl)indazole |
| SMILES | COC(OC)c1ccc(/C(F)=C/c2nn(C3CCCCO3)c3ccc(O[C@H](C)c4ccncc4Cl)cc23)cn1 |
| InChI | InChI=1S/C29H30ClFN4O4/c1-18(21-11-12-32-17-23(21)30)39-20-8-10-27-22(14-20)26(34-35(27)28-6-4-5-13-38-28)15-24(31)19-7-9-25(33-16-19)29(36-2)37-3/h7-12,14-18,28-29H,4-6,13H2,1-3H3/b24-15-/t18-,28?/m1/s1 |
| InChIKey | MWBCIEAJKASGKG-QLDVFQFTSA-N |
| XLogP | 7.08 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|