C24H21Cl2FIN4O3P — CID 145256566
[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]indazol-1-yl]-iodophosphane (PubChem CID 145256566) has the molecular formula C24H21Cl2FIN4O3P and a molecular weight of 661.24 g/mol. Its IUPAC name is [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]indazol-1-yl]-iodophosphane.
| Compound Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]indazol-1-yl]-iodophosphane |
|---|---|
| PubChem CID | 145256566 |
| Molecular Formula | C24H21Cl2FIN4O3P |
| Molecular Weight | 661.24 g/mol |
| Exact Mass | 659.98 |
| IUPAC Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-2-[6-(dimethoxymethyl)-3-pyridinyl]-2-fluoroethenyl]indazol-1-yl]-iodophosphane |
| SMILES | COC(OC)c1ccc(/C(F)=C/c2nn(PI)c3ccc(OC(C)c4c(Cl)cncc4Cl)cc23)cn1 |
| InChI | InChI=1S/C24H21Cl2FIN4O3P/c1-13(23-17(25)11-29-12-18(23)26)35-15-5-7-22-16(8-15)21(31-32(22)36-28)9-19(27)14-4-6-20(30-10-14)24(33-2)34-3/h4-13,24,36H,1-3H3/b19-9- |
| InChIKey | DTXWYESESZOEJK-OCKHKDLRSA-N |
| XLogP | 7.82 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.24 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|