C21H17Cl2IN5O4P — CID 145256573
[6-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-iodophosphanylindazol-3-yl]ethenyl]pyridazin-3-yl]methanetriol (PubChem CID 145256573) has the molecular formula C21H17Cl2IN5O4P and a molecular weight of 632.18 g/mol. Its IUPAC name is [6-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-iodophosphanylindazol-3-yl]ethenyl]pyridazin-3-yl]methanetriol.
| Compound Name | [6-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-iodophosphanylindazol-3-yl]ethenyl]pyridazin-3-yl]methanetriol |
|---|---|
| PubChem CID | 145256573 |
| Molecular Formula | C21H17Cl2IN5O4P |
| Molecular Weight | 632.18 g/mol |
| Exact Mass | 630.94 |
| IUPAC Name | [6-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-iodophosphanylindazol-3-yl]ethenyl]pyridazin-3-yl]methanetriol |
| SMILES | CC(Oc1ccc2c(c1)c(/C=C/c1ccc(C(O)(O)O)nn1)nn2PI)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C21H17Cl2IN5O4P/c1-11(20-15(22)9-25-10-16(20)23)33-13-4-6-18-14(8-13)17(28-29(18)34-24)5-2-12-3-7-19(27-26-12)21(30,31)32/h2-11,30-32,34H,1H3/b5-2+ |
| InChIKey | CNFGTCAOYVWAOQ-GORDUTHDSA-N |
| XLogP | 4.72 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.18 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|