C25H23Cl2FIN6O2P — CID 135301016
[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-1-fluoro-2-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]ethenyl]indazol-1-yl]-iodophosphane (PubChem CID 135301016) has the molecular formula C25H23Cl2FIN6O2P and a molecular weight of 687.28 g/mol. Its IUPAC name is [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-1-fluoro-2-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]ethenyl]indazol-1-yl]-iodophosphane.
| Compound Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-1-fluoro-2-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]ethenyl]indazol-1-yl]-iodophosphane |
|---|---|
| PubChem CID | 135301016 |
| Molecular Formula | C25H23Cl2FIN6O2P |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 686.00 |
| IUPAC Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(Z)-1-fluoro-2-[6-(morpholin-4-ylmethyl)pyridazin-3-yl]ethenyl]indazol-1-yl]-iodophosphane |
| SMILES | CC(Oc1ccc2c(c1)c(/C(F)=C/c1ccc(CN3CCOCC3)nn1)nn2PI)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C25H23Cl2FIN6O2P/c1-15(24-20(26)12-30-13-21(24)27)37-18-4-5-23-19(11-18)25(33-35(23)38-29)22(28)10-16-2-3-17(32-31-16)14-34-6-8-36-9-7-34/h2-5,10-13,15,38H,6-9,14H2,1H3/b22-10- |
| InChIKey | FDBXRSYDUAJWTA-YVNNLAQVSA-N |
| XLogP | 6.76 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|