C11H20N2O4S2 — CID 134594490
2-amino-3-[2-[2-amino-2-(3-hydroxyoxiran-2-yl)ethyl]sulfanylcyclobutyl]sulfanylpropanoic acid (PubChem CID 134594490) has the molecular formula C11H20N2O4S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-amino-3-[2-[2-amino-2-(3-hydroxyoxiran-2-yl)ethyl]sulfanylcyclobutyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[2-[2-amino-2-(3-hydroxyoxiran-2-yl)ethyl]sulfanylcyclobutyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134594490 |
| Molecular Formula | C11H20N2O4S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-amino-3-[2-[2-amino-2-(3-hydroxyoxiran-2-yl)ethyl]sulfanylcyclobutyl]sulfanylpropanoic acid |
| SMILES | NC(CSC1CCC1SCC(N)C1OC1O)C(=O)O |
| InChI | InChI=1S/C11H20N2O4S2/c12-5(9-11(16)17-9)3-18-7-1-2-8(7)19-4-6(13)10(14)15/h5-9,11,16H,1-4,12-13H2,(H,14,15) |
| InChIKey | XAEXQHIBYTWIAE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|