C9H17NO4S — CID 118169315
(2R)-2-amino-3-[[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methylsulfanyl]propanoic acid (PubChem CID 118169315) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 118169315 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (2R)-2-amino-3-[[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]methylsulfanyl]propanoic acid |
| SMILES | N[C@@H](CSC[C@@H]1CC[C@H](CO)O1)C(=O)O |
| InChI | InChI=1S/C9H17NO4S/c10-8(9(12)13)5-15-4-7-2-1-6(3-11)14-7/h6-8,11H,1-5,10H2,(H,12,13)/t6-,7+,8+/m1/s1 |
| InChIKey | WDDGBMDBXMISRQ-CSMHCCOUSA-N |
| XLogP | -0.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |