C5H11N3O2S — CID 154662210
(2R)-2-amino-3-(diaziridin-3-ylmethylsulfanyl)propanoic acid (PubChem CID 154662210) has the molecular formula C5H11N3O2S and a molecular weight of 177.23 g/mol. Its IUPAC name is (2R)-2-amino-3-(diaziridin-3-ylmethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(diaziridin-3-ylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 154662210 |
| Molecular Formula | C5H11N3O2S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2R)-2-amino-3-(diaziridin-3-ylmethylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSCC1NN1)C(=O)O |
| InChI | InChI=1S/C5H11N3O2S/c6-3(5(9)10)1-11-2-4-7-8-4/h3-4,7-8H,1-2,6H2,(H,9,10)/t3-/m0/s1 |
| InChIKey | YTNYFRJRLSHSQK-VKHMYHEASA-N |
| XLogP | -1.43 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|