C13H12Cl2O — CID 134597496
(Z,2E)-5-chloro-1-(4-chlorophenyl)-2-ethylidenepent-3-en-1-one (PubChem CID 134597496) has the molecular formula C13H12Cl2O and a molecular weight of 255.14 g/mol. Its IUPAC name is (Z,2E)-5-chloro-1-(4-chlorophenyl)-2-ethylidenepent-3-en-1-one.
| Compound Name | (Z,2E)-5-chloro-1-(4-chlorophenyl)-2-ethylidenepent-3-en-1-one |
|---|---|
| PubChem CID | 134597496 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (Z,2E)-5-chloro-1-(4-chlorophenyl)-2-ethylidenepent-3-en-1-one |
| SMILES | C/C=C(\C=C/CCl)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12Cl2O/c1-2-10(4-3-9-14)13(16)11-5-7-12(15)8-6-11/h2-8H,9H2,1H3/b4-3-,10-2+ |
| InChIKey | BUJXTSPRNDFDPI-MXSDMKSISA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|