C41H28Cl2F6O4 — CID 163696010
(Z,2E)-5-chloro-1-[4-[4-[2-[4-[4-(4-chlorobenzoyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-ethylidenepent-3-en-1-one (PubChem CID 163696010) has the molecular formula C41H28Cl2F6O4 and a molecular weight of 769.57 g/mol. Its IUPAC name is (Z,2E)-5-chloro-1-[4-[4-[2-[4-[4-(4-chlorobenzoyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-ethylidenepent-3-en-1-one.
| Compound Name | (Z,2E)-5-chloro-1-[4-[4-[2-[4-[4-(4-chlorobenzoyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-ethylidenepent-3-en-1-one |
|---|---|
| PubChem CID | 163696010 |
| Molecular Formula | C41H28Cl2F6O4 |
| Molecular Weight | 769.57 g/mol |
| Exact Mass | 768.13 |
| IUPAC Name | (Z,2E)-5-chloro-1-[4-[4-[2-[4-[4-(4-chlorobenzoyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-ethylidenepent-3-en-1-one |
| SMILES | C/C=C(\C=C/CCl)C(=O)c1ccc(Oc2ccc(C(c3ccc(Oc4ccc(C(=O)c5ccc(Cl)cc5)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C41H28Cl2F6O4/c1-2-26(4-3-25-42)37(50)28-7-17-33(18-8-28)52-35-21-11-30(12-22-35)39(40(44,45)46,41(47,48)49)31-13-23-36(24-14-31)53-34-19-9-29(10-20-34)38(51)27-5-15-32(43)16-6-27/h2-24H,25H2,1H3/b4-3-,26-2+ |
| InChIKey | JXAFEKLPIYEELD-UVOJZKGNSA-N |
| XLogP | 12.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.57 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|