C20H20O3 — CID 170154355
(Z,2E)-2-ethylidene-1-[4-(4-hydroxyphenoxy)phenyl]hex-3-en-1-one (PubChem CID 170154355) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-1-[4-(4-hydroxyphenoxy)phenyl]hex-3-en-1-one.
| Compound Name | (Z,2E)-2-ethylidene-1-[4-(4-hydroxyphenoxy)phenyl]hex-3-en-1-one |
|---|---|
| PubChem CID | 170154355 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (Z,2E)-2-ethylidene-1-[4-(4-hydroxyphenoxy)phenyl]hex-3-en-1-one |
| SMILES | C/C=C(\C=C/CC)C(=O)c1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H20O3/c1-3-5-6-15(4-2)20(22)16-7-11-18(12-8-16)23-19-13-9-17(21)10-14-19/h4-14,21H,3H2,1-2H3/b6-5-,15-4+ |
| InChIKey | SDSOWWRFPQJVIN-LFZRQRCSSA-N |
| XLogP | 5.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|