C21H22O3 — CID 170154328
(Z,2E)-2-ethylidene-1-[4-(4-methoxyphenoxy)phenyl]hex-3-en-1-one (PubChem CID 170154328) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-1-[4-(4-methoxyphenoxy)phenyl]hex-3-en-1-one.
| Compound Name | (Z,2E)-2-ethylidene-1-[4-(4-methoxyphenoxy)phenyl]hex-3-en-1-one |
|---|---|
| PubChem CID | 170154328 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (Z,2E)-2-ethylidene-1-[4-(4-methoxyphenoxy)phenyl]hex-3-en-1-one |
| SMILES | C/C=C(\C=C/CC)C(=O)c1ccc(Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H22O3/c1-4-6-7-16(5-2)21(22)17-8-10-19(11-9-17)24-20-14-12-18(23-3)13-15-20/h5-15H,4H2,1-3H3/b7-6-,16-5+ |
| InChIKey | ODGRWJCINPGSAR-PIEALQRTSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|