C39H38F6O3 — CID 137394987
(4-tert-butylphenyl)-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(3S)-3-methylhex-5-en-3-yl]oxyphenyl]propan-2-yl]phenoxy]phenyl]methanone (PubChem CID 137394987) has the molecular formula C39H38F6O3 and a molecular weight of 668.72 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(3S)-3-methylhex-5-en-3-yl]oxyphenyl]propan-2-yl]phenoxy]phenyl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(3S)-3-methylhex-5-en-3-yl]oxyphenyl]propan-2-yl]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 137394987 |
| Molecular Formula | C39H38F6O3 |
| Molecular Weight | 668.72 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | (4-tert-butylphenyl)-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(3S)-3-methylhex-5-en-3-yl]oxyphenyl]propan-2-yl]phenoxy]phenyl]methanone |
| SMILES | C=CC[C@](C)(CC)Oc1ccc(C(c2ccc(Oc3ccc(C(=O)c4ccc(C(C)(C)C)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H38F6O3/c1-7-25-36(6,8-2)48-33-23-17-30(18-24-33)37(38(40,41)42,39(43,44)45)29-15-21-32(22-16-29)47-31-19-11-27(12-20-31)34(46)26-9-13-28(14-10-26)35(3,4)5/h7,9-24H,1,8,25H2,2-6H3/t36-/m0/s1 |
| InChIKey | LVAWORIWUVSWGK-BHVANESWSA-N |
| XLogP | 11.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.72 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|