C9H16F3NOS — CID 134600010
(3S)-3-[methyl-(1,1,1-trifluoro-4-sulfanylbutan-2-yl)amino]butan-2-one (PubChem CID 134600010) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is (3S)-3-[methyl-(1,1,1-trifluoro-4-sulfanylbutan-2-yl)amino]butan-2-one.
| Compound Name | (3S)-3-[methyl-(1,1,1-trifluoro-4-sulfanylbutan-2-yl)amino]butan-2-one |
|---|---|
| PubChem CID | 134600010 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (3S)-3-[methyl-(1,1,1-trifluoro-4-sulfanylbutan-2-yl)amino]butan-2-one |
| SMILES | CC(=O)[C@H](C)N(C)C(CCS)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NOS/c1-6(7(2)14)13(3)8(4-5-15)9(10,11)12/h6,8,15H,4-5H2,1-3H3/t6-,8?/m0/s1 |
| InChIKey | LAHVSKJQLWGDTK-UUEFVBAFSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|