C7H15NOS2 — CID 23104527
N,N-dimethyl-4-sulfanyl-2-(sulfanylmethyl)butanamide (PubChem CID 23104527) has the molecular formula C7H15NOS2 and a molecular weight of 193.34 g/mol. Its IUPAC name is N,N-dimethyl-4-sulfanyl-2-(sulfanylmethyl)butanamide.
| Compound Name | N,N-dimethyl-4-sulfanyl-2-(sulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 23104527 |
| Molecular Formula | C7H15NOS2 |
| Molecular Weight | 193.34 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | N,N-dimethyl-4-sulfanyl-2-(sulfanylmethyl)butanamide |
| SMILES | CN(C)C(=O)C(CS)CCS |
| InChI | InChI=1S/C7H15NOS2/c1-8(2)7(9)6(5-11)3-4-10/h6,10-11H,3-5H2,1-2H3 |
| InChIKey | NLWUFUILIQSNIL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|