C13H23F3N2O2S2 — CID 134606802
4-[[4,4,4-trifluoro-3-[methyl-[(2S)-3-oxobutan-2-yl]amino]butyl]disulfanyl]butanamide (PubChem CID 134606802) has the molecular formula C13H23F3N2O2S2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 4-[[4,4,4-trifluoro-3-[methyl-[(2S)-3-oxobutan-2-yl]amino]butyl]disulfanyl]butanamide.
| Compound Name | 4-[[4,4,4-trifluoro-3-[methyl-[(2S)-3-oxobutan-2-yl]amino]butyl]disulfanyl]butanamide |
|---|---|
| PubChem CID | 134606802 |
| Molecular Formula | C13H23F3N2O2S2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-[[4,4,4-trifluoro-3-[methyl-[(2S)-3-oxobutan-2-yl]amino]butyl]disulfanyl]butanamide |
| SMILES | CC(=O)[C@H](C)N(C)C(CCSSCCCC(N)=O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O2S2/c1-9(10(2)19)18(3)11(13(14,15)16)6-8-22-21-7-4-5-12(17)20/h9,11H,4-8H2,1-3H3,(H2,17,20)/t9-,11?/m0/s1 |
| InChIKey | OYQYNBNJQLVALB-FTNKSUMCSA-N |
| XLogP | 2.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|