C17H28N2O — CID 134600168
1-(3,5-ditert-butyl-4-nitrosophenyl)-N,N-dimethylmethanamine (PubChem CID 134600168) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-nitrosophenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3,5-ditert-butyl-4-nitrosophenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 134600168 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-nitrosophenyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc(C(C)(C)C)c(N=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O/c1-16(2,3)13-9-12(11-19(7)8)10-14(15(13)18-20)17(4,5)6/h9-10H,11H2,1-8H3 |
| InChIKey | WHFBBKHMGYVLEM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |