C26H36N2 — CID 134601278
1-N,3-dimethyl-4-[1-[8-methyl-7-(2-methylprop-2-enyl)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]benzene-1,2-diamine (PubChem CID 134601278) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1-N,3-dimethyl-4-[1-[8-methyl-7-(2-methylprop-2-enyl)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]benzene-1,2-diamine.
| Compound Name | 1-N,3-dimethyl-4-[1-[8-methyl-7-(2-methylprop-2-enyl)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 134601278 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1-N,3-dimethyl-4-[1-[8-methyl-7-(2-methylprop-2-enyl)-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]benzene-1,2-diamine |
| SMILES | C=C(C)CC1CCc2ccc(C(CC)c3ccc(NC)c(N)c3C)cc2C1C |
| InChI | InChI=1S/C26H36N2/c1-7-22(23-12-13-25(28-6)26(27)18(23)5)21-11-9-19-8-10-20(14-16(2)3)17(4)24(19)15-21/h9,11-13,15,17,20,22,28H,2,7-8,10,14,27H2,1,3-6H3 |
| InChIKey | NAJSHZOOCGZRCR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|