C24H34N2O3 — CID 142376552
6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol;methyl formate (PubChem CID 142376552) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol;methyl formate.
| Compound Name | 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol;methyl formate |
|---|---|
| PubChem CID | 142376552 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol;methyl formate |
| SMILES | CNc1ccc(C(c2ccc3c(c2)C(O)CC3)C(C)(C)C)c(C)c1N.COC=O |
| InChI | InChI=1S/C22H30N2O.C2H4O2/c1-13-16(9-10-18(24-5)21(13)23)20(22(2,3)4)15-7-6-14-8-11-19(25)17(14)12-15;1-4-2-3/h6-7,9-10,12,19-20,24-25H,8,11,23H2,1-5H3;2H,1H3 |
| InChIKey | YPDKIWCLPFGXCR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|