C25H23N3O2 — CID 134603468
6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-phenoxy-1,8-naphthyridin-4-one (PubChem CID 134603468) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-phenoxy-1,8-naphthyridin-4-one.
| Compound Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-phenoxy-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 134603468 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-phenoxy-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(Oc2ccccc2)c(=O)c2cc(NC3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C25H23N3O2/c1-2-28-16-23(30-21-10-4-3-5-11-21)24(29)22-14-20(15-26-25(22)28)27-19-12-17-8-6-7-9-18(17)13-19/h3-11,14-16,19,27H,2,12-13H2,1H3 |
| InChIKey | MQBHITSOBCXPCA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |