C16H26N4OS — CID 134603490
4-sulfanylidene-2-undecyl-1,6-dihydropyrazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 134603490) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-sulfanylidene-2-undecyl-1,6-dihydropyrazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 4-sulfanylidene-2-undecyl-1,6-dihydropyrazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 134603490 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-sulfanylidene-2-undecyl-1,6-dihydropyrazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | CCCCCCCCCCCc1nc(=S)n2[nH]c(=O)cc2[nH]1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-3-4-5-6-7-8-9-10-11-13-17-14-12-15(21)19-20(14)16(22)18-13/h12H,2-11H2,1H3,(H,19,21)(H,17,18,22) |
| InChIKey | JYMAWGPPCDYJMO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|