C14H22N4S2 — CID 57350118
8-heptyl-1,3-dimethyl-7H-purine-2,6-dithione (PubChem CID 57350118) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 8-heptyl-1,3-dimethyl-7H-purine-2,6-dithione.
| Compound Name | 8-heptyl-1,3-dimethyl-7H-purine-2,6-dithione |
|---|---|
| PubChem CID | 57350118 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 8-heptyl-1,3-dimethyl-7H-purine-2,6-dithione |
| SMILES | CCCCCCCc1nc2c([nH]1)c(=S)n(C)c(=S)n2C |
| InChI | InChI=1S/C14H22N4S2/c1-4-5-6-7-8-9-10-15-11-12(16-10)17(2)14(20)18(3)13(11)19/h4-9H2,1-3H3,(H,15,16) |
| InChIKey | JXTAOGAZDZPMOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|