C9H13N5S2 — CID 57352263
8-(2-aminoethyl)-1,3-dimethyl-7H-purine-2,6-dithione (PubChem CID 57352263) has the molecular formula C9H13N5S2 and a molecular weight of 255.37 g/mol. Its IUPAC name is 8-(2-aminoethyl)-1,3-dimethyl-7H-purine-2,6-dithione.
| Compound Name | 8-(2-aminoethyl)-1,3-dimethyl-7H-purine-2,6-dithione |
|---|---|
| PubChem CID | 57352263 |
| Molecular Formula | C9H13N5S2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 8-(2-aminoethyl)-1,3-dimethyl-7H-purine-2,6-dithione |
| SMILES | Cn1c(=S)c2[nH]c(CCN)nc2n(C)c1=S |
| InChI | InChI=1S/C9H13N5S2/c1-13-7-6(8(15)14(2)9(13)16)11-5(12-7)3-4-10/h3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | HOGHVIJAZZRKLM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|