C7H8N4S2 — CID 5376024
1,3-dimethyl-7H-purine-2,6-dithione (PubChem CID 5376024) has the molecular formula C7H8N4S2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1,3-dimethyl-7H-purine-2,6-dithione.
| Compound Name | 1,3-dimethyl-7H-purine-2,6-dithione |
|---|---|
| PubChem CID | 5376024 |
| Molecular Formula | C7H8N4S2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dithione |
| SMILES | Cn1c(=S)c2[nH]cnc2n(C)c1=S |
| InChI | InChI=1S/C7H8N4S2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9) |
| InChIKey | SGAYEAJACSIURJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|