C6H6N4S2 — CID 131073202
3-methyl-7H-purine-2,6-dithione (PubChem CID 131073202) has the molecular formula C6H6N4S2 and a molecular weight of 198.28 g/mol. Its IUPAC name is 3-methyl-7H-purine-2,6-dithione.
| Compound Name | 3-methyl-7H-purine-2,6-dithione |
|---|---|
| PubChem CID | 131073202 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 3-methyl-7H-purine-2,6-dithione |
| SMILES | Cn1c(=S)[nH]c(=S)c2[nH]cnc21 |
| InChI | InChI=1S/C6H6N4S2/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2H,1H3,(H,7,8)(H,9,11,12) |
| InChIKey | CEFAIWNRABCQMQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|