C7H12N2S — CID 134612584
6-propan-2-yl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 134612584) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 6-propan-2-yl-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 6-propan-2-yl-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 134612584 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 6-propan-2-yl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC(C)C1=CCNC(=S)N1 |
| InChI | InChI=1S/C7H12N2S/c1-5(2)6-3-4-8-7(10)9-6/h3,5H,4H2,1-2H3,(H2,8,9,10) |
| InChIKey | UBGXSQFKPWNYPM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|