C12H23ClN2S — CID 87882205
4,6-dimethyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride (PubChem CID 87882205) has the molecular formula C12H23ClN2S and a molecular weight of 262.85 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride.
| Compound Name | 4,6-dimethyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
|---|---|
| PubChem CID | 87882205 |
| Molecular Formula | C12H23ClN2S |
| Molecular Weight | 262.85 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4,6-dimethyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
| SMILES | CCCN1C(=S)[NH+](CCC)C(C)=CC1C.[Cl-] |
| InChI | InChI=1S/C12H22N2S.ClH/c1-5-7-13-10(3)9-11(4)14(8-6-2)12(13)15;/h9-10H,5-8H2,1-4H3;1H |
| InChIKey | PCSORDUGMNTAPD-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.85 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|