C10H19ClN2S — CID 87882220
1,3-diethyl-4,6-dimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride (PubChem CID 87882220) has the molecular formula C10H19ClN2S and a molecular weight of 234.80 g/mol. Its IUPAC name is 1,3-diethyl-4,6-dimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride.
| Compound Name | 1,3-diethyl-4,6-dimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
|---|---|
| PubChem CID | 87882220 |
| Molecular Formula | C10H19ClN2S |
| Molecular Weight | 234.80 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1,3-diethyl-4,6-dimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
| SMILES | CCN1C(=S)[NH+](CC)C(C)=CC1C.[Cl-] |
| InChI | InChI=1S/C10H18N2S.ClH/c1-5-11-8(3)7-9(4)12(6-2)10(11)13;/h7-8H,5-6H2,1-4H3;1H |
| InChIKey | XRQZSIWGIWHNEP-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.80 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|