C11H21ClN2S — CID 87882222
4-methyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride (PubChem CID 87882222) has the molecular formula C11H21ClN2S and a molecular weight of 248.82 g/mol. Its IUPAC name is 4-methyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride.
| Compound Name | 4-methyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
|---|---|
| PubChem CID | 87882222 |
| Molecular Formula | C11H21ClN2S |
| Molecular Weight | 248.82 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-methyl-1,3-dipropyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
| SMILES | CCCN1C(=S)[NH+](CCC)C=CC1C.[Cl-] |
| InChI | InChI=1S/C11H20N2S.ClH/c1-4-7-12-9-6-10(3)13(8-5-2)11(12)14;/h6,9-10H,4-5,7-8H2,1-3H3;1H |
| InChIKey | FLHMGSPXHKZXNV-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.82 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|